File path: /jruby-1.4.0/src/org/jruby/ext/socket/RubyUNIXSocket.java | File path: /jruby-1.4.0/src/org/jruby/ext/socket/RubyUNIXSocket.java | |||
Method name: int write(ByteBuffer)
|
Method name: int read(ByteBuffer)
|
|||
Number of AST nodes: 5 | Number of AST nodes: 5 | |||
1 | int max = src.remaining();↵ | 1 | int max = dst.remaining();↵ | |
2 | int v = INSTANCE.send(fd, src, max, 0);↵ | 2 | int v = INSTANCE.recv(fd, dst, max, 0);↵ | |
3 | if(v != -1) {↵ | 3 | if(v != -1) {↵ | |
4 | src.position(src.position()+v);↵ | 4 | dst.position(dst.position()+v);↵ | |
5 | }↵ | 5 | }↵ | |
6 | return v; | 6 |
| |
See real code fragment | See real code fragment |
Number of common nesting structure subtrees | 1 |
Number of refactorable cases | 0 |
Number of non-refactorable cases | 1 |
Time elapsed for finding largest common nesting structure subtrees (ms) | 0.1 |
Clones location | Clones are declared in the same class |
Number of node comparisons | 13 |
Number of mapped statements | 5 |
Number of unmapped statements in the first code fragment | 0 |
Number of unmapped statements in the second code fragment | 0 |
Time elapsed for statement mapping (ms) | 1.5 |
Clone type | Type 2 |
ID | Statement | ID | Statement | ||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
1 | int max = src.remaining(); |
| 1 | int max = dst.remaining(); | |||||||||||||||
2 | int v = INSTANCE.send(fd, src, max, 0); |
| 2 | int v = INSTANCE.recv(fd, dst, max, 0); | |||||||||||||||
3 | if (v != -1) | 3 | if (v != -1) | ||||||||||||||||
4 | src.position(src.position() + v); |
| 4 | dst.position(dst.position() + v); | |||||||||||||||
5 | return v; | 5 | return v; |
Row | Violation |
---|---|
1 | Expression INSTANCE.send(fd,src,max,0) cannot be parameterized, because it has dependencies to/from statements that will be extracted |
2 | Expression INSTANCE.recv(fd,dst,max,0) cannot be parameterized, because it has dependencies to/from statements that will be extracted |